About 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol
4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 21278600) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 21278600 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | NCC1(N)C=C(N)C=CC1O |
| InChI | InChI=1S/C7H13N3O/c8-4-7(10)3-5(9)1-2-6(7)11/h1-3,6,11H,4,8-10H2 |
| InChIKey | RATDZSIGVLVTOI-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol (CID 21278600) is 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol is NCC1(N)C=C(N)C=CC1O.
What is the InChIKey of 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol?
The InChIKey is RATDZSIGVLVTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c8-4-7(10)3-5(9)1-2-6(7)11/h1-3,6,11H,4,8-10H2.
What are the key properties of 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol?
4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol has a molecular weight of 155.20 g/mol, XLogP of -1.58, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diamino-6-(aminomethyl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 21278600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).