About 4-cyclodecyl-2,6-dimethylmorpholine acetate
4-cyclodecyl-2,6-dimethylmorpholine acetate (PubChem CID 21278745) has the molecular formula C18H34NO3-
and a molecular weight of 312.47 g/mol. Its IUPAC name is 4-cyclodecyl-2,6-dimethylmorpholine acetate.
Molecular Properties
| Compound Name | 4-cyclodecyl-2,6-dimethylmorpholine acetate |
| PubChem CID | 21278745 |
| Molecular Formula | C18H34NO3- |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 4-cyclodecyl-2,6-dimethylmorpholine acetate |
| SMILES | CC(=O)[O-].CC1CN(C2CCCCCCCCC2)CC(C)O1 |
| InChI | InChI=1S/C16H31NO.C2H4O2/c1-14-12-17(13-15(2)18-14)16-10-8-6-4-3-5-7-9-11-16;1-2(3)4/h14-16H,3-13H2,1-2H3;1H3,(H,3,4)/p-1 |
| InChIKey | YISWLIADKXFJBR-UHFFFAOYSA-M |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclodecyl-2,6-dimethylmorpholine acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclodecyl-2,6-dimethylmorpholine acetate?
The IUPAC name of 4-cyclodecyl-2,6-dimethylmorpholine acetate (CID 21278745) is 4-cyclodecyl-2,6-dimethylmorpholine acetate.
What is the SMILES notation for 4-cyclodecyl-2,6-dimethylmorpholine acetate?
The canonical SMILES for 4-cyclodecyl-2,6-dimethylmorpholine acetate is CC(=O)[O-].CC1CN(C2CCCCCCCCC2)CC(C)O1.
What is the InChIKey of 4-cyclodecyl-2,6-dimethylmorpholine acetate?
The InChIKey is YISWLIADKXFJBR-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H31NO.C2H4O2/c1-14-12-17(13-15(2)18-14)16-10-8-6-4-3-5-7-9-11-16;1-2(3)4/h14-16H,3-13H2,1-2H3;1H3,(H,3,4)/p-1.
What are the key properties of 4-cyclodecyl-2,6-dimethylmorpholine acetate?
4-cyclodecyl-2,6-dimethylmorpholine acetate has a molecular weight of 312.47 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclodecyl-2,6-dimethylmorpholine acetate is sourced from PubChem (CID 21278745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).