About cyclohexyl 2-pyridin-2-ylpropanoate
cyclohexyl 2-pyridin-2-ylpropanoate (PubChem CID 21278953) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is cyclohexyl 2-pyridin-2-ylpropanoate.
Molecular Properties
| Compound Name | cyclohexyl 2-pyridin-2-ylpropanoate |
| PubChem CID | 21278953 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | cyclohexyl 2-pyridin-2-ylpropanoate |
| SMILES | CC(C(=O)OC1CCCCC1)c1ccccn1 |
| InChI | InChI=1S/C14H19NO2/c1-11(13-9-5-6-10-15-13)14(16)17-12-7-3-2-4-8-12/h5-6,9-12H,2-4,7-8H2,1H3 |
| InChIKey | RTGKSBPSGAPJSF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl 2-pyridin-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-pyridin-2-ylpropanoate?
The IUPAC name of cyclohexyl 2-pyridin-2-ylpropanoate (CID 21278953) is cyclohexyl 2-pyridin-2-ylpropanoate.
What is the SMILES notation for cyclohexyl 2-pyridin-2-ylpropanoate?
The canonical SMILES for cyclohexyl 2-pyridin-2-ylpropanoate is CC(C(=O)OC1CCCCC1)c1ccccn1.
What is the InChIKey of cyclohexyl 2-pyridin-2-ylpropanoate?
The InChIKey is RTGKSBPSGAPJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-11(13-9-5-6-10-15-13)14(16)17-12-7-3-2-4-8-12/h5-6,9-12H,2-4,7-8H2,1H3.
What are the key properties of cyclohexyl 2-pyridin-2-ylpropanoate?
cyclohexyl 2-pyridin-2-ylpropanoate has a molecular weight of 233.31 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-pyridin-2-ylpropanoate is sourced from PubChem (CID 21278953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).