C11H16N2 — CID 21278980
N-(cyclopropylmethyl)-1-pyridin-2-ylethanamine (PubChem CID 21278980) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-pyridin-2-ylethanamine.
| Compound Name | N-(cyclopropylmethyl)-1-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 21278980 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-(cyclopropylmethyl)-1-pyridin-2-ylethanamine |
| SMILES | CC(NCC1CC1)c1ccccn1 |
| InChI | InChI=1S/C11H16N2/c1-9(13-8-10-5-6-10)11-4-2-3-7-12-11/h2-4,7,9-10,13H,5-6,8H2,1H3 |
| InChIKey | RNSIJOYBGOREED-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |