About N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide
N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide (PubChem CID 21279278) has the molecular formula C6H5F3N2O2
and a molecular weight of 194.11 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide |
| PubChem CID | 21279278 |
| Molecular Formula | C6H5F3N2O2 |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide |
| SMILES | CC(=O)Nc1cc(C(F)(F)F)no1 |
| InChI | InChI=1S/C6H5F3N2O2/c1-3(12)10-5-2-4(11-13-5)6(7,8)9/h2H,1H3,(H,10,12) |
| InChIKey | KKHMJANPVRFCAR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide?
The IUPAC name of N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide (CID 21279278) is N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide.
What is the SMILES notation for N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide?
The canonical SMILES for N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide is CC(=O)Nc1cc(C(F)(F)F)no1.
What is the InChIKey of N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide?
The InChIKey is KKHMJANPVRFCAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2O2/c1-3(12)10-5-2-4(11-13-5)6(7,8)9/h2H,1H3,(H,10,12).
What are the key properties of N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide?
N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide has a molecular weight of 194.11 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide is sourced from PubChem (CID 21279278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).