About 3-ethyl-1-phenylpyrrole
3-ethyl-1-phenylpyrrole (PubChem CID 21279644) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-ethyl-1-phenylpyrrole.
Molecular Properties
| Compound Name | 3-ethyl-1-phenylpyrrole |
| PubChem CID | 21279644 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-ethyl-1-phenylpyrrole |
| SMILES | CCc1ccn(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H13N/c1-2-11-8-9-13(10-11)12-6-4-3-5-7-12/h3-10H,2H2,1H3 |
| InChIKey | NIBNIYBSUWLRRZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1-phenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-phenylpyrrole?
The IUPAC name of 3-ethyl-1-phenylpyrrole (CID 21279644) is 3-ethyl-1-phenylpyrrole.
What is the SMILES notation for 3-ethyl-1-phenylpyrrole?
The canonical SMILES for 3-ethyl-1-phenylpyrrole is CCc1ccn(-c2ccccc2)c1.
What is the InChIKey of 3-ethyl-1-phenylpyrrole?
The InChIKey is NIBNIYBSUWLRRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-2-11-8-9-13(10-11)12-6-4-3-5-7-12/h3-10H,2H2,1H3.
What are the key properties of 3-ethyl-1-phenylpyrrole?
3-ethyl-1-phenylpyrrole has a molecular weight of 171.24 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-phenylpyrrole is sourced from PubChem (CID 21279644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).