C11H12F3N5S2 — CID 21279752
1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 21279752) has the molecular formula C11H12F3N5S2 and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 21279752 |
| Molecular Formula | C11H12F3N5S2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | N#CCCCSc1nccc(NC(=S)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H12F3N5S2/c12-11(13,14)7-17-9(20)18-8-3-5-16-10(19-8)21-6-2-1-4-15/h3,5H,1-2,6-7H2,(H2,16,17,18,19,20) |
| InChIKey | MHAKCHRESXGCOM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|