C12H19F3N6O — CID 21279757
methyl 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanimidate (PubChem CID 21279757) has the molecular formula C12H19F3N6O and a molecular weight of 320.32 g/mol. Its IUPAC name is methyl 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanimidate.
| Compound Name | methyl 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanimidate |
|---|---|
| PubChem CID | 21279757 |
| Molecular Formula | C12H19F3N6O |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | methyl 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanimidate |
| SMILES | [H]/N=C(/CCCCn1ccc(N/C(N)=N/CC(F)(F)F)n1)OC |
| InChI | InChI=1S/C12H19F3N6O/c1-22-9(16)4-2-3-6-21-7-5-10(20-21)19-11(17)18-8-12(13,14)15/h5,7,16H,2-4,6,8H2,1H3,(H3,17,18,19,20)/b16-9- |
| InChIKey | VNGKMKSEKNKIIY-SXGWCWSVSA-N |
| XLogP | 1.97 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|