C16H21F3N8 — CID 21279758
1-[2-[5-(4-aminopyrimidin-2-yl)pentyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21279758) has the molecular formula C16H21F3N8 and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-[2-[5-(4-aminopyrimidin-2-yl)pentyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-[5-(4-aminopyrimidin-2-yl)pentyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21279758 |
| Molecular Formula | C16H21F3N8 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-[2-[5-(4-aminopyrimidin-2-yl)pentyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccnc(CCCCCc2nccc(N)n2)n1 |
| InChI | InChI=1S/C16H21F3N8/c17-16(18,19)10-24-15(21)27-14-7-9-23-13(26-14)5-3-1-2-4-12-22-8-6-11(20)25-12/h6-9H,1-5,10H2,(H2,20,22,25)(H3,21,23,24,26,27) |
| InChIKey | ORICGGVLZPORII-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 127.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|