C12H15F3N8S — CID 21279759
N'-cyano-4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanimidamide (PubChem CID 21279759) has the molecular formula C12H15F3N8S and a molecular weight of 360.37 g/mol. Its IUPAC name is N'-cyano-4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanimidamide.
| Compound Name | N'-cyano-4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanimidamide |
|---|---|
| PubChem CID | 21279759 |
| Molecular Formula | C12H15F3N8S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N'-cyano-4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanimidamide |
| SMILES | N#C/N=C(\N)CCCSc1nccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H15F3N8S/c13-12(14,15)6-20-10(18)22-9-3-4-19-11(23-9)24-5-1-2-8(17)21-7-16/h3-4H,1-2,5-6H2,(H2,17,21)(H3,18,19,20,22,23) |
| InChIKey | YGGIBVGJYFNQAJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|