C13H18F3N7S — CID 21279761
1-[2-[3-(4,5-dihydro-1H-imidazol-2-yl)propylsulfanyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21279761) has the molecular formula C13H18F3N7S and a molecular weight of 361.40 g/mol. Its IUPAC name is 1-[2-[3-(4,5-dihydro-1H-imidazol-2-yl)propylsulfanyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-[3-(4,5-dihydro-1H-imidazol-2-yl)propylsulfanyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21279761 |
| Molecular Formula | C13H18F3N7S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-[2-[3-(4,5-dihydro-1H-imidazol-2-yl)propylsulfanyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccnc(SCCCC2=NCCN2)n1 |
| InChI | InChI=1S/C13H18F3N7S/c14-13(15,16)8-21-11(17)22-10-3-4-20-12(23-10)24-7-1-2-9-18-5-6-19-9/h3-4H,1-2,5-8H2,(H,18,19)(H3,17,20,21,22,23) |
| InChIKey | XCRLWGVINBKLJZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|