C13H17F3N6S — CID 21279762
1-[2-(5-cyanopentylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21279762) has the molecular formula C13H17F3N6S and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[2-(5-cyanopentylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-(5-cyanopentylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21279762 |
| Molecular Formula | C13H17F3N6S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[2-(5-cyanopentylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N#CCCCCCSc1nccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C13H17F3N6S/c14-13(15,16)9-20-11(18)21-10-5-7-19-12(22-10)23-8-4-2-1-3-6-17/h5,7H,1-4,8-9H2,(H3,18,19,20,21,22) |
| InChIKey | PPKVTTIYGIKNLL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|