C8H11F3N4O2S — CID 21279763
1-[1-(2-hydroxyethyl)pyrazol-3-yl]-3-(2,2,2-trifluoroethylsulfanyl)urea (PubChem CID 21279763) has the molecular formula C8H11F3N4O2S and a molecular weight of 284.26 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethyl)pyrazol-3-yl]-3-(2,2,2-trifluoroethylsulfanyl)urea.
| Compound Name | 1-[1-(2-hydroxyethyl)pyrazol-3-yl]-3-(2,2,2-trifluoroethylsulfanyl)urea |
|---|---|
| PubChem CID | 21279763 |
| Molecular Formula | C8H11F3N4O2S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-[1-(2-hydroxyethyl)pyrazol-3-yl]-3-(2,2,2-trifluoroethylsulfanyl)urea |
| SMILES | O=C(NSCC(F)(F)F)Nc1ccn(CCO)n1 |
| InChI | InChI=1S/C8H11F3N4O2S/c9-8(10,11)5-18-14-7(17)12-6-1-2-15(13-6)3-4-16/h1-2,16H,3-5H2,(H2,12,13,14,17) |
| InChIKey | JISXBWRMVLQVMR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|