C11H13F3N6S — CID 21279772
1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21279772) has the molecular formula C11H13F3N6S and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21279772 |
| Molecular Formula | C11H13F3N6S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N#CCCCSc1nccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H13F3N6S/c12-11(13,14)7-18-9(16)19-8-3-5-17-10(20-8)21-6-2-1-4-15/h3,5H,1-2,6-7H2,(H3,16,17,18,19,20) |
| InChIKey | HKRDXQCSFJGOLB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|