C12H14F3N7OS — CID 21279793
1-[2-[2-(1H-imidazol-2-ylsulfanyl)ethoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21279793) has the molecular formula C12H14F3N7OS and a molecular weight of 361.35 g/mol. Its IUPAC name is 1-[2-[2-(1H-imidazol-2-ylsulfanyl)ethoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-[2-(1H-imidazol-2-ylsulfanyl)ethoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21279793 |
| Molecular Formula | C12H14F3N7OS |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-[2-[2-(1H-imidazol-2-ylsulfanyl)ethoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccnc(OCCSc2ncc[nH]2)n1 |
| InChI | InChI=1S/C12H14F3N7OS/c13-12(14,15)7-20-9(16)21-8-1-2-17-10(22-8)23-5-6-24-11-18-3-4-19-11/h1-4H,5-7H2,(H,18,19)(H3,16,17,20,21,22) |
| InChIKey | ADSDXUZUXJDJOF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|