C14H18F4N8S — CID 21279817
1-[2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propylsulfanyl]pyrimidin-4-yl]-2-(2,2,3,3-tetrafluoropropyl)guanidine (PubChem CID 21279817) has the molecular formula C14H18F4N8S and a molecular weight of 406.41 g/mol. Its IUPAC name is 1-[2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propylsulfanyl]pyrimidin-4-yl]-2-(2,2,3,3-tetrafluoropropyl)guanidine.
| Compound Name | 1-[2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propylsulfanyl]pyrimidin-4-yl]-2-(2,2,3,3-tetrafluoropropyl)guanidine |
|---|---|
| PubChem CID | 21279817 |
| Molecular Formula | C14H18F4N8S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propylsulfanyl]pyrimidin-4-yl]-2-(2,2,3,3-tetrafluoropropyl)guanidine |
| SMILES | Cc1nc(CCCSc2nccc(N/C(N)=N/CC(F)(F)C(F)F)n2)n[nH]1 |
| InChI | InChI=1S/C14H18F4N8S/c1-8-22-10(26-25-8)3-2-6-27-13-20-5-4-9(24-13)23-12(19)21-7-14(17,18)11(15)16/h4-5,11H,2-3,6-7H2,1H3,(H,22,25,26)(H3,19,20,21,23,24) |
| InChIKey | STWXLUWBOMCWFE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|