C12H15F3N6O — CID 21279822
1-[2-[2-(2-cyanoethoxy)ethyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21279822) has the molecular formula C12H15F3N6O and a molecular weight of 316.29 g/mol. Its IUPAC name is 1-[2-[2-(2-cyanoethoxy)ethyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-[2-(2-cyanoethoxy)ethyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21279822 |
| Molecular Formula | C12H15F3N6O |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-[2-[2-(2-cyanoethoxy)ethyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N#CCCOCCc1nccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H15F3N6O/c13-12(14,15)8-19-11(17)21-10-2-5-18-9(20-10)3-7-22-6-1-4-16/h2,5H,1,3,6-8H2,(H3,17,18,19,20,21) |
| InChIKey | TVZCIVRFRUXHIQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|