C13H17F6N7S — CID 21279829
N'-(2,2,2-trifluoroethyl)-4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanimidamide (PubChem CID 21279829) has the molecular formula C13H17F6N7S and a molecular weight of 417.38 g/mol. Its IUPAC name is N'-(2,2,2-trifluoroethyl)-4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanimidamide.
| Compound Name | N'-(2,2,2-trifluoroethyl)-4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanimidamide |
|---|---|
| PubChem CID | 21279829 |
| Molecular Formula | C13H17F6N7S |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N'-(2,2,2-trifluoroethyl)-4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanimidamide |
| SMILES | N/C(CCCSc1nccc(N/C(N)=N/CC(F)(F)F)n1)=N\CC(F)(F)F |
| InChI | InChI=1S/C13H17F6N7S/c14-12(15,16)6-23-8(20)2-1-5-27-11-22-4-3-9(26-11)25-10(21)24-7-13(17,18)19/h3-4H,1-2,5-7H2,(H2,20,23)(H3,21,22,24,25,26) |
| InChIKey | WADUSYRHDGUZQY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|