C11H15F3N6O — CID 21279852
1-[1-[2-(2-cyanoethoxy)ethyl]pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21279852) has the molecular formula C11H15F3N6O and a molecular weight of 304.28 g/mol. Its IUPAC name is 1-[1-[2-(2-cyanoethoxy)ethyl]pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[1-[2-(2-cyanoethoxy)ethyl]pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21279852 |
| Molecular Formula | C11H15F3N6O |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-[1-[2-(2-cyanoethoxy)ethyl]pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N#CCCOCCn1ccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H15F3N6O/c12-11(13,14)8-17-10(16)18-9-2-4-20(19-9)5-7-21-6-1-3-15/h2,4H,1,5-8H2,(H3,16,17,18,19) |
| InChIKey | GAWUTBWBYPACGD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|