About 4-methyl-1,3-dioxolan-2-one;oxolane
4-methyl-1,3-dioxolan-2-one;oxolane (PubChem CID 21280178) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is 4-methyl-1,3-dioxolan-2-one;oxolane.
Molecular Properties
| Compound Name | 4-methyl-1,3-dioxolan-2-one;oxolane |
| PubChem CID | 21280178 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-methyl-1,3-dioxolan-2-one;oxolane |
| SMILES | C1CCOC1.C1CCOC1.CC1COC(=O)O1 |
| InChI | InChI=1S/C4H6O3.2C4H8O/c1-3-2-6-4(5)7-3;2*1-2-4-5-3-1/h3H,2H2,1H3;2*1-4H2 |
| InChIKey | RVHFHXDPGFZCIS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-1,3-dioxolan-2-one;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-dioxolan-2-one;oxolane?
The IUPAC name of 4-methyl-1,3-dioxolan-2-one;oxolane (CID 21280178) is 4-methyl-1,3-dioxolan-2-one;oxolane.
What is the SMILES notation for 4-methyl-1,3-dioxolan-2-one;oxolane?
The canonical SMILES for 4-methyl-1,3-dioxolan-2-one;oxolane is C1CCOC1.C1CCOC1.CC1COC(=O)O1.
What is the InChIKey of 4-methyl-1,3-dioxolan-2-one;oxolane?
The InChIKey is RVHFHXDPGFZCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.2C4H8O/c1-3-2-6-4(5)7-3;2*1-2-4-5-3-1/h3H,2H2,1H3;2*1-4H2.
What are the key properties of 4-methyl-1,3-dioxolan-2-one;oxolane?
4-methyl-1,3-dioxolan-2-one;oxolane has a molecular weight of 246.30 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-dioxolan-2-one;oxolane is sourced from PubChem (CID 21280178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).