C9H18BrNO — CID 21280647
2,4,4-trimethyl-3-prop-2-enyl-1,3-oxazolidin-3-ium bromide (PubChem CID 21280647) has the molecular formula C9H18BrNO and a molecular weight of 236.15 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-prop-2-enyl-1,3-oxazolidin-3-ium bromide.
| Compound Name | 2,4,4-trimethyl-3-prop-2-enyl-1,3-oxazolidin-3-ium bromide |
|---|---|
| PubChem CID | 21280647 |
| Molecular Formula | C9H18BrNO |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2,4,4-trimethyl-3-prop-2-enyl-1,3-oxazolidin-3-ium bromide |
| SMILES | C=CC[NH+]1C(C)OCC1(C)C.[Br-] |
| InChI | InChI=1S/C9H17NO.BrH/c1-5-6-10-8(2)11-7-9(10,3)4;/h5,8H,1,6-7H2,2-4H3;1H |
| InChIKey | SGAYPWBJTGZDLF-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|