C24H31NO — CID 21280848
6-(1,4,5,7-tetramethylanthracen-9-yl)oxyhexan-1-amine (PubChem CID 21280848) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 6-(1,4,5,7-tetramethylanthracen-9-yl)oxyhexan-1-amine.
| Compound Name | 6-(1,4,5,7-tetramethylanthracen-9-yl)oxyhexan-1-amine |
|---|---|
| PubChem CID | 21280848 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 6-(1,4,5,7-tetramethylanthracen-9-yl)oxyhexan-1-amine |
| SMILES | Cc1cc(C)c2cc3c(C)ccc(C)c3c(OCCCCCCN)c2c1 |
| InChI | InChI=1S/C24H31NO/c1-16-13-19(4)20-15-21-17(2)9-10-18(3)23(21)24(22(20)14-16)26-12-8-6-5-7-11-25/h9-10,13-15H,5-8,11-12,25H2,1-4H3 |
| InChIKey | ZIDLGSDDVMCGEL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|