C15H30N2O — CID 21280930
2-amino-1-(3,3,5-trimethylazepan-1-yl)hexan-1-one (PubChem CID 21280930) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-amino-1-(3,3,5-trimethylazepan-1-yl)hexan-1-one.
| Compound Name | 2-amino-1-(3,3,5-trimethylazepan-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 21280930 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2-amino-1-(3,3,5-trimethylazepan-1-yl)hexan-1-one |
| SMILES | CCCCC(N)C(=O)N1CCC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H30N2O/c1-5-6-7-13(16)14(18)17-9-8-12(2)10-15(3,4)11-17/h12-13H,5-11,16H2,1-4H3 |
| InChIKey | AZKBYNNDSKGZCK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |