About [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate
[3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate (PubChem CID 21281083) has the molecular formula C25H27FO5S
and a molecular weight of 458.55 g/mol. Its IUPAC name is [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate |
| PubChem CID | 21281083 |
| Molecular Formula | C25H27FO5S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)COCc2ccc(F)c(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H27FO5S/c1-19-9-12-22(13-10-19)32(27,28)30-18-25(2,3)17-29-16-20-11-14-23(26)24(15-20)31-21-7-5-4-6-8-21/h4-15H,16-18H2,1-3H3 |
| InChIKey | ZQDWJNZEPBURIV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate?
The IUPAC name of [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate (CID 21281083) is [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate?
The canonical SMILES for [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC(C)(C)COCc2ccc(F)c(Oc3ccccc3)c2)cc1.
What is the InChIKey of [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate?
The InChIKey is ZQDWJNZEPBURIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27FO5S/c1-19-9-12-22(13-10-19)32(27,28)30-18-25(2,3)17-29-16-20-11-14-23(26)24(15-20)31-21-7-5-4-6-8-21/h4-15H,16-18H2,1-3H3.
What are the key properties of [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate?
[3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate has a molecular weight of 458.55 g/mol, XLogP of 5.87, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-fluoro-3-phenoxyphenyl)methoxy]-2,2-dimethylpropyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 21281083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).