About 4-hexylisoindole-1,3-dione
4-hexylisoindole-1,3-dione (PubChem CID 21281291) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is 4-hexylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 4-hexylisoindole-1,3-dione |
| PubChem CID | 21281291 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 4-hexylisoindole-1,3-dione |
| SMILES | CCCCCCc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C14H17NO2/c1-2-3-4-5-7-10-8-6-9-11-12(10)14(17)15-13(11)16/h6,8-9H,2-5,7H2,1H3,(H,15,16,17) |
| InChIKey | NHNFPXZIQXUTOH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-hexylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexylisoindole-1,3-dione?
The IUPAC name of 4-hexylisoindole-1,3-dione (CID 21281291) is 4-hexylisoindole-1,3-dione.
What is the SMILES notation for 4-hexylisoindole-1,3-dione?
The canonical SMILES for 4-hexylisoindole-1,3-dione is CCCCCCc1cccc2c1C(=O)NC2=O.
What is the InChIKey of 4-hexylisoindole-1,3-dione?
The InChIKey is NHNFPXZIQXUTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c1-2-3-4-5-7-10-8-6-9-11-12(10)14(17)15-13(11)16/h6,8-9H,2-5,7H2,1H3,(H,15,16,17).
What are the key properties of 4-hexylisoindole-1,3-dione?
4-hexylisoindole-1,3-dione has a molecular weight of 231.29 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexylisoindole-1,3-dione is sourced from PubChem (CID 21281291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).