C17H15ClF4O — CID 21281355
1-(5-chloropentoxy)-3-(2,6-difluorophenyl)-2,4-difluorobenzene (PubChem CID 21281355) has the molecular formula C17H15ClF4O and a molecular weight of 346.75 g/mol. Its IUPAC name is 1-(5-chloropentoxy)-3-(2,6-difluorophenyl)-2,4-difluorobenzene.
| Compound Name | 1-(5-chloropentoxy)-3-(2,6-difluorophenyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 21281355 |
| Molecular Formula | C17H15ClF4O |
| Molecular Weight | 346.75 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-(5-chloropentoxy)-3-(2,6-difluorophenyl)-2,4-difluorobenzene |
| SMILES | Fc1cccc(F)c1-c1c(F)ccc(OCCCCCCl)c1F |
| InChI | InChI=1S/C17H15ClF4O/c18-9-2-1-3-10-23-14-8-7-13(21)16(17(14)22)15-11(19)5-4-6-12(15)20/h4-8H,1-3,9-10H2 |
| InChIKey | RSULHERMDMAPRL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|