C17H16ClNO3 — CID 2128159
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3-methylbenzoate (PubChem CID 2128159) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3-methylbenzoate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 2128159 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H16ClNO3/c1-12-3-2-4-14(9-12)17(21)22-11-16(20)19-10-13-5-7-15(18)8-6-13/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | AUJBECVZNVHWMP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |