C10H20N2 — CID 21281613
2,2,5,5-tetramethylhexane-3,4-diimine (PubChem CID 21281613) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2,2,5,5-tetramethylhexane-3,4-diimine.
| Compound Name | 2,2,5,5-tetramethylhexane-3,4-diimine |
|---|---|
| PubChem CID | 21281613 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2,2,5,5-tetramethylhexane-3,4-diimine |
| SMILES | [H]/N=C(C(=N/[H])/C(C)(C)C)\C(C)(C)C |
| InChI | InChI=1S/C10H20N2/c1-9(2,3)7(11)8(12)10(4,5)6/h11-12H,1-6H3/b11-7-,12-8- |
| InChIKey | VASVCHNTASGSMF-OXAWKVHCSA-N |
| XLogP | 3.12 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|