About 3,5,5-trimethylcyclohex-2-en-1-one;urea
3,5,5-trimethylcyclohex-2-en-1-one;urea (PubChem CID 21282221) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 3,5,5-trimethylcyclohex-2-en-1-one;urea.
Molecular Properties
| Compound Name | 3,5,5-trimethylcyclohex-2-en-1-one;urea |
| PubChem CID | 21282221 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3,5,5-trimethylcyclohex-2-en-1-one;urea |
| SMILES | CC1=CC(=O)CC(C)(C)C1.NC(N)=O |
| InChI | InChI=1S/C9H14O.CH4N2O/c1-7-4-8(10)6-9(2,3)5-7;2-1(3)4/h4H,5-6H2,1-3H3;(H4,2,3,4) |
| InChIKey | LXYNBUKRPHFJRY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5,5-trimethylcyclohex-2-en-1-one;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,5-trimethylcyclohex-2-en-1-one;urea?
The IUPAC name of 3,5,5-trimethylcyclohex-2-en-1-one;urea (CID 21282221) is 3,5,5-trimethylcyclohex-2-en-1-one;urea.
What is the SMILES notation for 3,5,5-trimethylcyclohex-2-en-1-one;urea?
The canonical SMILES for 3,5,5-trimethylcyclohex-2-en-1-one;urea is CC1=CC(=O)CC(C)(C)C1.NC(N)=O.
What is the InChIKey of 3,5,5-trimethylcyclohex-2-en-1-one;urea?
The InChIKey is LXYNBUKRPHFJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.CH4N2O/c1-7-4-8(10)6-9(2,3)5-7;2-1(3)4/h4H,5-6H2,1-3H3;(H4,2,3,4).
What are the key properties of 3,5,5-trimethylcyclohex-2-en-1-one;urea?
3,5,5-trimethylcyclohex-2-en-1-one;urea has a molecular weight of 198.27 g/mol, XLogP of 1.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,5-trimethylcyclohex-2-en-1-one;urea is sourced from PubChem (CID 21282221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).