About 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide
1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide (PubChem CID 21282594) has the molecular formula C10H8Cl2N4O
and a molecular weight of 271.11 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide |
| PubChem CID | 21282594 |
| Molecular Formula | C10H8Cl2N4O |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cn(Cc2c(Cl)cccc2Cl)nn1 |
| InChI | InChI=1S/C10H8Cl2N4O/c11-7-2-1-3-8(12)6(7)4-16-5-9(10(13)17)14-15-16/h1-3,5H,4H2,(H2,13,17) |
| InChIKey | KMIOSMWHWBHDTK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide?
The IUPAC name of 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide (CID 21282594) is 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide.
What is the SMILES notation for 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide?
The canonical SMILES for 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide is NC(=O)c1cn(Cc2c(Cl)cccc2Cl)nn1.
What is the InChIKey of 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide?
The InChIKey is KMIOSMWHWBHDTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N4O/c11-7-2-1-3-8(12)6(7)4-16-5-9(10(13)17)14-15-16/h1-3,5H,4H2,(H2,13,17).
What are the key properties of 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide?
1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide has a molecular weight of 271.11 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-dichlorophenyl)methyl]triazole-4-carboxamide is sourced from PubChem (CID 21282594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).