About 1,2,3-tripropyltriazinane
1,2,3-tripropyltriazinane (PubChem CID 21282708) has the molecular formula C12H27N3
and a molecular weight of 213.37 g/mol. Its IUPAC name is 1,2,3-tripropyltriazinane.
Molecular Properties
| Compound Name | 1,2,3-tripropyltriazinane |
| PubChem CID | 21282708 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 1,2,3-tripropyltriazinane |
| SMILES | CCCN1CCCN(CCC)N1CCC |
| InChI | InChI=1S/C12H27N3/c1-4-8-13-11-7-12-14(9-5-2)15(13)10-6-3/h4-12H2,1-3H3 |
| InChIKey | VRKGZUPKXLPFOE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,3-tripropyltriazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-tripropyltriazinane?
The IUPAC name of 1,2,3-tripropyltriazinane (CID 21282708) is 1,2,3-tripropyltriazinane.
What is the SMILES notation for 1,2,3-tripropyltriazinane?
The canonical SMILES for 1,2,3-tripropyltriazinane is CCCN1CCCN(CCC)N1CCC.
What is the InChIKey of 1,2,3-tripropyltriazinane?
The InChIKey is VRKGZUPKXLPFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3/c1-4-8-13-11-7-12-14(9-5-2)15(13)10-6-3/h4-12H2,1-3H3.
What are the key properties of 1,2,3-tripropyltriazinane?
1,2,3-tripropyltriazinane has a molecular weight of 213.37 g/mol, XLogP of 2.36, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-tripropyltriazinane is sourced from PubChem (CID 21282708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).