C11H13N5O3S — CID 21282810
1-(azidomethyl)-2,2-dioxo-3-propan-2-yl-2λ6,1,3-benzothiadiazin-4-one (PubChem CID 21282810) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is 1-(azidomethyl)-2,2-dioxo-3-propan-2-yl-2λ6,1,3-benzothiadiazin-4-one.
| Compound Name | 1-(azidomethyl)-2,2-dioxo-3-propan-2-yl-2λ6,1,3-benzothiadiazin-4-one |
|---|---|
| PubChem CID | 21282810 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-(azidomethyl)-2,2-dioxo-3-propan-2-yl-2λ6,1,3-benzothiadiazin-4-one |
| SMILES | CC(C)N1C(=O)c2ccccc2N(CN=[N+]=[N-])S1(=O)=O |
| InChI | InChI=1S/C11H13N5O3S/c1-8(2)16-11(17)9-5-3-4-6-10(9)15(7-13-14-12)20(16,18)19/h3-6,8H,7H2,1-2H3 |
| InChIKey | MXMNGDQFGWILSP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 106.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|