C19H17N5O — CID 21283341
2-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine (PubChem CID 21283341) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine.
| Compound Name | 2-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine |
|---|---|
| PubChem CID | 21283341 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine |
| SMILES | c1ccc(-c2nnc3c4ccccc4c(C4CNCCO4)nn23)cc1 |
| InChI | InChI=1S/C19H17N5O/c1-2-6-13(7-3-1)18-21-22-19-15-9-5-4-8-14(15)17(23-24(18)19)16-12-20-10-11-25-16/h1-9,16,20H,10-12H2 |
| InChIKey | QNCXPUXFNJJRGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |