C15H18Cl2N2O2 — CID 2128346
2,4-dichloro-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzamide (PubChem CID 2128346) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 2128346 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2,4-dichloro-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzamide |
| SMILES | CC1CCN(C(=O)CNC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-10-4-6-19(7-5-10)14(20)9-18-15(21)12-3-2-11(16)8-13(12)17/h2-3,8,10H,4-7,9H2,1H3,(H,18,21) |
| InChIKey | CZYFBBPWDPPXPV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |