About (4,4-dimethylcyclohexyl) hydrogen carbonate
(4,4-dimethylcyclohexyl) hydrogen carbonate (PubChem CID 21283480) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4,4-dimethylcyclohexyl) hydrogen carbonate |
| PubChem CID | 21283480 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (4,4-dimethylcyclohexyl) hydrogen carbonate |
| SMILES | CC1(C)CCC(OC(=O)O)CC1 |
| InChI | InChI=1S/C9H16O3/c1-9(2)5-3-7(4-6-9)12-8(10)11/h7H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | HSMDNTDCXRNHSI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,4-dimethylcyclohexyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethylcyclohexyl) hydrogen carbonate?
The IUPAC name of (4,4-dimethylcyclohexyl) hydrogen carbonate (CID 21283480) is (4,4-dimethylcyclohexyl) hydrogen carbonate.
What is the SMILES notation for (4,4-dimethylcyclohexyl) hydrogen carbonate?
The canonical SMILES for (4,4-dimethylcyclohexyl) hydrogen carbonate is CC1(C)CCC(OC(=O)O)CC1.
What is the InChIKey of (4,4-dimethylcyclohexyl) hydrogen carbonate?
The InChIKey is HSMDNTDCXRNHSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-9(2)5-3-7(4-6-9)12-8(10)11/h7H,3-6H2,1-2H3,(H,10,11).
What are the key properties of (4,4-dimethylcyclohexyl) hydrogen carbonate?
(4,4-dimethylcyclohexyl) hydrogen carbonate has a molecular weight of 172.22 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethylcyclohexyl) hydrogen carbonate is sourced from PubChem (CID 21283480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).