C21H15Cl2FN4O2 — CID 2128351
(E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 2128351) has the molecular formula C21H15Cl2FN4O2 and a molecular weight of 445.28 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 2128351 |
| Molecular Formula | C21H15Cl2FN4O2 |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C/c2c(C)nn(-c3ccc(F)cc3)c2Cl)cc1Cl |
| InChI | InChI=1S/C21H15Cl2FN4O2/c1-12-17(20(23)28(27-12)16-6-3-14(24)4-7-16)9-13(11-25)21(29)26-15-5-8-19(30-2)18(22)10-15/h3-10H,1-2H3,(H,26,29)/b13-9+ |
| InChIKey | USNZFCKBPGZNAH-UKTHLTGXSA-N |
| XLogP | 5.18 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|