About 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide
3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide (PubChem CID 21284040) has the molecular formula C18H30N2O4
and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide |
| PubChem CID | 21284040 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide |
| SMILES | CC(CC(=O)N(C)C)C1CC(=O)C(C(C)CC(=O)N(C)C)CC1=O |
| InChI | InChI=1S/C18H30N2O4/c1-11(7-17(23)19(3)4)13-9-16(22)14(10-15(13)21)12(2)8-18(24)20(5)6/h11-14H,7-10H2,1-6H3 |
| InChIKey | KICRURDDDXCTOA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide?
The IUPAC name of 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide (CID 21284040) is 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide.
What is the SMILES notation for 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide?
The canonical SMILES for 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide is CC(CC(=O)N(C)C)C1CC(=O)C(C(C)CC(=O)N(C)C)CC1=O.
What is the InChIKey of 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide?
The InChIKey is KICRURDDDXCTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O4/c1-11(7-17(23)19(3)4)13-9-16(22)14(10-15(13)21)12(2)8-18(24)20(5)6/h11-14H,7-10H2,1-6H3.
What are the key properties of 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide?
3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide has a molecular weight of 338.45 g/mol, XLogP of 1.38, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(dimethylamino)-4-oxobutan-2-yl]-2,5-dioxocyclohexyl]-N,N-dimethylbutanamide is sourced from PubChem (CID 21284040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).