About bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate
bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate (PubChem CID 21284182) has the molecular formula C34H25N2O4PPdS
and a molecular weight of 695.05 g/mol. Its IUPAC name is bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate.
Molecular Properties
| Compound Name | bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate |
| PubChem CID | 21284182 |
| Molecular Formula | C34H25N2O4PPdS |
| Molecular Weight | 695.05 g/mol |
| Exact Mass | 694.03 |
| IUPAC Name | bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate |
| SMILES | O=S(=O)([O-])[O-].[Pd+2].c1ccc(-c2ccnc(Pc3nccc(-c4ccccc4)c3-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H25N2P.H2O4S.Pd/c1-5-13-25(14-6-1)29-21-23-35-33(31(29)27-17-9-3-10-18-27)37-34-32(28-19-11-4-12-20-28)30(22-24-36-34)26-15-7-2-8-16-26;1-5(2,3)4;/h1-24,37H;(H2,1,2,3,4);/q;;+2/p-2 |
| InChIKey | FWWMQJXANUMRJT-UHFFFAOYSA-L |
| XLogP | 6.43 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 695.05 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate?
The IUPAC name of bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate (CID 21284182) is bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate.
What is the SMILES notation for bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate?
The canonical SMILES for bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate is O=S(=O)([O-])[O-].[Pd+2].c1ccc(-c2ccnc(Pc3nccc(-c4ccccc4)c3-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate?
The InChIKey is FWWMQJXANUMRJT-UHFFFAOYSA-L. The full InChI is InChI=1S/C34H25N2P.H2O4S.Pd/c1-5-13-25(14-6-1)29-21-23-35-33(31(29)27-17-9-3-10-18-27)37-34-32(28-19-11-4-12-20-28)30(22-24-36-34)26-15-7-2-8-16-26;1-5(2,3)4;/h1-24,37H;(H2,1,2,3,4);/q;;+2/p-2.
What are the key properties of bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate?
bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate has a molecular weight of 695.05 g/mol, XLogP of 6.43, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,4-diphenyl-2-pyridinyl)phosphane;palladium(2+);sulfate is sourced from PubChem (CID 21284182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).