C31H39ClN2O6S — CID 21284328
4-methyl-2-[4-[5-[methyl-[(2,3,4-trimethoxyphenoxy)methyl]amino]pentoxy]phenyl]-1,4-benzothiazin-3-one;hydrochloride (PubChem CID 21284328) has the molecular formula C31H39ClN2O6S and a molecular weight of 603.18 g/mol. Its IUPAC name is 4-methyl-2-[4-[5-[methyl-[(2,3,4-trimethoxyphenoxy)methyl]amino]pentoxy]phenyl]-1,4-benzothiazin-3-one;hydrochloride.
| Compound Name | 4-methyl-2-[4-[5-[methyl-[(2,3,4-trimethoxyphenoxy)methyl]amino]pentoxy]phenyl]-1,4-benzothiazin-3-one;hydrochloride |
|---|---|
| PubChem CID | 21284328 |
| Molecular Formula | C31H39ClN2O6S |
| Molecular Weight | 603.18 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 4-methyl-2-[4-[5-[methyl-[(2,3,4-trimethoxyphenoxy)methyl]amino]pentoxy]phenyl]-1,4-benzothiazin-3-one;hydrochloride |
| SMILES | COc1ccc(OCN(C)CCCCCOc2ccc(C3Sc4ccccc4N(C)C3=O)cc2)c(OC)c1OC.Cl |
| InChI | InChI=1S/C31H38N2O6S.ClH/c1-32(21-39-26-18-17-25(35-3)28(36-4)29(26)37-5)19-9-6-10-20-38-23-15-13-22(14-16-23)30-31(34)33(2)24-11-7-8-12-27(24)40-30;/h7-8,11-18,30H,6,9-10,19-21H2,1-5H3;1H |
| InChIKey | VCKNMUMFFLCYNK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.18 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|