C10H14N6O2 — CID 21285052
formaldehyde;phenol;1,3,5-triazine-2,4,6-triamine (PubChem CID 21285052) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is formaldehyde;phenol;1,3,5-triazine-2,4,6-triamine.
| Compound Name | formaldehyde;phenol;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 21285052 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | formaldehyde;phenol;1,3,5-triazine-2,4,6-triamine |
| SMILES | C=O.Nc1nc(N)nc(N)n1.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.C3H6N6.CH2O/c7-6-4-2-1-3-5-6;4-1-7-2(5)9-3(6)8-1;1-2/h1-5,7H;(H6,4,5,6,7,8,9);1H2 |
| InChIKey | CGXBXJAUUWZZOP-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |