C16H26O2 — CID 21285753
1,2-bis(butan-2-yloxymethyl)benzene (PubChem CID 21285753) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1,2-bis(butan-2-yloxymethyl)benzene.
| Compound Name | 1,2-bis(butan-2-yloxymethyl)benzene |
|---|---|
| PubChem CID | 21285753 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1,2-bis(butan-2-yloxymethyl)benzene |
| SMILES | CCC(C)OCc1ccccc1COC(C)CC |
| InChI | InChI=1S/C16H26O2/c1-5-13(3)17-11-15-9-7-8-10-16(15)12-18-14(4)6-2/h7-10,13-14H,5-6,11-12H2,1-4H3 |
| InChIKey | YALIPZOOYXAGFD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |