C55H36N4O8 — CID 21285769
4-[24-benzyl-17,18,20-tris(4-carboxyphenyl)-22H-porphyrin-2-yl]benzoic acid (PubChem CID 21285769) has the molecular formula C55H36N4O8 and a molecular weight of 880.91 g/mol. Its IUPAC name is 4-[24-benzyl-17,18,20-tris(4-carboxyphenyl)-22H-porphyrin-2-yl]benzoic acid.
| Compound Name | 4-[24-benzyl-17,18,20-tris(4-carboxyphenyl)-22H-porphyrin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 21285769 |
| Molecular Formula | C55H36N4O8 |
| Molecular Weight | 880.91 g/mol |
| Exact Mass | 880.25 |
| IUPAC Name | 4-[24-benzyl-17,18,20-tris(4-carboxyphenyl)-22H-porphyrin-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2=Cc3cc4ccc(cc5nc(cc6c(-c7ccc(C(=O)O)cc7)c(-c7ccc(C(=O)O)cc7)c(c(-c7ccc(C(=O)O)cc7)c2n3)n6Cc2ccccc2)C=C5)[nH]4)cc1 |
| InChI | InChI=1S/C55H36N4O8/c60-52(61)36-14-6-32(7-15-36)45-28-44-27-42-23-22-40(56-42)26-41-24-25-43(57-41)29-46-47(33-8-16-37(17-9-33)53(62)63)48(34-10-18-38(19-11-34)54(64)65)51(59(46)30-31-4-2-1-3-5-31)49(50(45)58-44)35-12-20-39(21-13-35)55(66)67/h1-29,56H,30H2,(H,60,61)(H,62,63)(H,64,65)(H,66,67)/b40-26-,41-26-,42-27-,43-29-,44-27-,46-29-,50-49-,51-49- |
| InChIKey | OWPZODYYAXNEIH-WDJLXGTHSA-N |
| XLogP | 11.39 |
| TPSA | 195.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.91 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |