C8H10F6N2O4 — CID 21286260
2,3-dihydroxy-N,N'-bis(2,2,2-trifluoroethyl)butanediamide (PubChem CID 21286260) has the molecular formula C8H10F6N2O4 and a molecular weight of 312.17 g/mol. Its IUPAC name is 2,3-dihydroxy-N,N'-bis(2,2,2-trifluoroethyl)butanediamide.
| Compound Name | 2,3-dihydroxy-N,N'-bis(2,2,2-trifluoroethyl)butanediamide |
|---|---|
| PubChem CID | 21286260 |
| Molecular Formula | C8H10F6N2O4 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2,3-dihydroxy-N,N'-bis(2,2,2-trifluoroethyl)butanediamide |
| SMILES | O=C(NCC(F)(F)F)C(O)C(O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H10F6N2O4/c9-7(10,11)1-15-5(19)3(17)4(18)6(20)16-2-8(12,13)14/h3-4,17-18H,1-2H2,(H,15,19)(H,16,20) |
| InChIKey | AGWRQANIGHSNQO-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |