About ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate
ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 21286944) has the molecular formula C12H14N2O4S
and a molecular weight of 282.32 g/mol. Its IUPAC name is ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate.
Molecular Properties
| Compound Name | ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| PubChem CID | 21286944 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | CCOC(=O)CCCC(=O)c1scc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C12H14N2O4S/c1-2-18-9(16)5-3-4-8(15)11-10-7(6-19-11)13-12(17)14-10/h6H,2-5H2,1H3,(H2,13,14,17) |
| InChIKey | AEQOFIUYCALBKP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate?
The IUPAC name of ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate (CID 21286944) is ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate.
What is the SMILES notation for ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate?
The canonical SMILES for ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate is CCOC(=O)CCCC(=O)c1scc2[nH]c(=O)[nH]c12.
What is the InChIKey of ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate?
The InChIKey is AEQOFIUYCALBKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4S/c1-2-18-9(16)5-3-4-8(15)11-10-7(6-19-11)13-12(17)14-10/h6H,2-5H2,1H3,(H2,13,14,17).
What are the key properties of ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate?
ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate has a molecular weight of 282.32 g/mol, XLogP of 1.83, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-oxo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate is sourced from PubChem (CID 21286944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).