About 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid
2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid (PubChem CID 21286998) has the molecular formula C18H27BrO5
and a molecular weight of 403.31 g/mol. Its IUPAC name is 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid |
| PubChem CID | 21286998 |
| Molecular Formula | C18H27BrO5 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid |
| SMILES | CCCC1(OCCCCCBr)CC(OCC(=O)O)=CC=C1C(C)=O |
| InChI | InChI=1S/C18H27BrO5/c1-3-9-18(24-11-6-4-5-10-19)12-15(23-13-17(21)22)7-8-16(18)14(2)20/h7-8H,3-6,9-13H2,1-2H3,(H,21,22) |
| InChIKey | OEPUVVCOLDYQRD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid?
The IUPAC name of 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid (CID 21286998) is 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid.
What is the SMILES notation for 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid?
The canonical SMILES for 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid is CCCC1(OCCCCCBr)CC(OCC(=O)O)=CC=C1C(C)=O.
What is the InChIKey of 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid?
The InChIKey is OEPUVVCOLDYQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27BrO5/c1-3-9-18(24-11-6-4-5-10-19)12-15(23-13-17(21)22)7-8-16(18)14(2)20/h7-8H,3-6,9-13H2,1-2H3,(H,21,22).
What are the key properties of 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid?
2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid has a molecular weight of 403.31 g/mol, XLogP of 4.01, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxyacetic acid is sourced from PubChem (CID 21286998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).