C23H27NO3 — CID 21287332
7-(1,3-dimethylazepan-4-yl)oxy-3-phenyl-2,3-dihydrochromen-4-one (PubChem CID 21287332) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 7-(1,3-dimethylazepan-4-yl)oxy-3-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | 7-(1,3-dimethylazepan-4-yl)oxy-3-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 21287332 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 7-(1,3-dimethylazepan-4-yl)oxy-3-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CC1CN(C)CCCC1Oc1ccc2c(c1)OCC(c1ccccc1)C2=O |
| InChI | InChI=1S/C23H27NO3/c1-16-14-24(2)12-6-9-21(16)27-18-10-11-19-22(13-18)26-15-20(23(19)25)17-7-4-3-5-8-17/h3-5,7-8,10-11,13,16,20-21H,6,9,12,14-15H2,1-2H3 |
| InChIKey | ZJDVUQYLMKKXGS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |