About N-pyridin-4-ylacetamide
N-pyridin-4-ylacetamide (PubChem CID 21288) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is N-pyridin-4-ylacetamide.
Molecular Properties
| Compound Name | N-pyridin-4-ylacetamide |
| PubChem CID | 21288 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | N-pyridin-4-ylacetamide |
| SMILES | CC(=O)Nc1ccncc1 |
| InChI | InChI=1S/C7H8N2O/c1-6(10)9-7-2-4-8-5-3-7/h2-5H,1H3,(H,8,9,10) |
| InChIKey | BIJAWQUBRNHZGE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-pyridin-4-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-4-ylacetamide?
The IUPAC name of N-pyridin-4-ylacetamide (CID 21288) is N-pyridin-4-ylacetamide.
What is the SMILES notation for N-pyridin-4-ylacetamide?
The canonical SMILES for N-pyridin-4-ylacetamide is CC(=O)Nc1ccncc1.
What is the InChIKey of N-pyridin-4-ylacetamide?
The InChIKey is BIJAWQUBRNHZGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-6(10)9-7-2-4-8-5-3-7/h2-5H,1H3,(H,8,9,10).
What are the key properties of N-pyridin-4-ylacetamide?
N-pyridin-4-ylacetamide has a molecular weight of 136.15 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-4-ylacetamide is sourced from PubChem (CID 21288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).