About 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine
4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine (PubChem CID 21288333) has the molecular formula C13H11NO3S
and a molecular weight of 261.30 g/mol. Its IUPAC name is 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine.
Molecular Properties
| Compound Name | 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine |
| PubChem CID | 21288333 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine |
| SMILES | O=[N+]([O-])C1=CCCC2=C1OC=C1C=CC=CC1S2 |
| InChI | InChI=1S/C13H11NO3S/c15-14(16)10-5-3-7-12-13(10)17-8-9-4-1-2-6-11(9)18-12/h1-2,4-6,8,11H,3,7H2 |
| InChIKey | GKIHLNBELBDRBS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine?
The IUPAC name of 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine (CID 21288333) is 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine.
What is the SMILES notation for 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine?
The canonical SMILES for 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine is O=[N+]([O-])C1=CCCC2=C1OC=C1C=CC=CC1S2.
What is the InChIKey of 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine?
The InChIKey is GKIHLNBELBDRBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3S/c15-14(16)10-5-3-7-12-13(10)17-8-9-4-1-2-6-11(9)18-12/h1-2,4-6,8,11H,3,7H2.
What are the key properties of 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine?
4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine has a molecular weight of 261.30 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepine is sourced from PubChem (CID 21288333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).