About tris(3-aminophenyl) phosphite
tris(3-aminophenyl) phosphite (PubChem CID 21288374) has the molecular formula C18H18N3O3P
and a molecular weight of 355.33 g/mol. Its IUPAC name is tris(3-aminophenyl) phosphite.
Molecular Properties
| Compound Name | tris(3-aminophenyl) phosphite |
| PubChem CID | 21288374 |
| Molecular Formula | C18H18N3O3P |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | tris(3-aminophenyl) phosphite |
| SMILES | Nc1cccc(OP(Oc2cccc(N)c2)Oc2cccc(N)c2)c1 |
| InChI | InChI=1S/C18H18N3O3P/c19-13-4-1-7-16(10-13)22-25(23-17-8-2-5-14(20)11-17)24-18-9-3-6-15(21)12-18/h1-12H,19-21H2 |
| InChIKey | DJAQSKNYTCQYLA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(3-aminophenyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(3-aminophenyl) phosphite?
The IUPAC name of tris(3-aminophenyl) phosphite (CID 21288374) is tris(3-aminophenyl) phosphite.
What is the SMILES notation for tris(3-aminophenyl) phosphite?
The canonical SMILES for tris(3-aminophenyl) phosphite is Nc1cccc(OP(Oc2cccc(N)c2)Oc2cccc(N)c2)c1.
What is the InChIKey of tris(3-aminophenyl) phosphite?
The InChIKey is DJAQSKNYTCQYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N3O3P/c19-13-4-1-7-16(10-13)22-25(23-17-8-2-5-14(20)11-17)24-18-9-3-6-15(21)12-18/h1-12H,19-21H2.
What are the key properties of tris(3-aminophenyl) phosphite?
tris(3-aminophenyl) phosphite has a molecular weight of 355.33 g/mol, XLogP of 4.20, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(3-aminophenyl) phosphite is sourced from PubChem (CID 21288374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).