About 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea
1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea (PubChem CID 21288564) has the molecular formula C12H13N5O4S2
and a molecular weight of 355.40 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea.
Molecular Properties
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea |
| PubChem CID | 21288564 |
| Molecular Formula | C12H13N5O4S2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea |
| SMILES | COc1cc(OC)nc(NC(=S)NS(=O)(=O)c2cccnc2)n1 |
| InChI | InChI=1S/C12H13N5O4S2/c1-20-9-6-10(21-2)15-11(14-9)16-12(22)17-23(18,19)8-4-3-5-13-7-8/h3-7H,1-2H3,(H2,14,15,16,17,22) |
| InChIKey | UZMFPQIUQDSMPG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea?
The IUPAC name of 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea (CID 21288564) is 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea.
What is the SMILES notation for 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea?
The canonical SMILES for 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea is COc1cc(OC)nc(NC(=S)NS(=O)(=O)c2cccnc2)n1.
What is the InChIKey of 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea?
The InChIKey is UZMFPQIUQDSMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O4S2/c1-20-9-6-10(21-2)15-11(14-9)16-12(22)17-23(18,19)8-4-3-5-13-7-8/h3-7H,1-2H3,(H2,14,15,16,17,22).
What are the key properties of 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea?
1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea has a molecular weight of 355.40 g/mol, XLogP of 0.56, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethoxypyrimidin-2-yl)-3-pyridin-3-ylsulfonylthiourea is sourced from PubChem (CID 21288564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).